C15H16BrN3O — CID 8982702
4-bromo-N-[(Z)-1-(3,4-dimethylphenyl)ethylideneamino]-1H-pyrrole-2-carboxamide (PubChem CID 8982702) has the molecular formula C15H16BrN3O and a molecular weight of 334.22 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-1-(3,4-dimethylphenyl)ethylideneamino]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[(Z)-1-(3,4-dimethylphenyl)ethylideneamino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 8982702 |
| Molecular Formula | C15H16BrN3O |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 4-bromo-N-[(Z)-1-(3,4-dimethylphenyl)ethylideneamino]-1H-pyrrole-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1cc(Br)c[nH]1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H16BrN3O/c1-9-4-5-12(6-10(9)2)11(3)18-19-15(20)14-7-13(16)8-17-14/h4-8,17H,1-3H3,(H,19,20)/b18-11- |
| InChIKey | NWPMJKZLNHIHDN-WQRHYEAKSA-N |
| XLogP | 3.55 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|