C18H24BrN4O2+ — CID 135839881
[5-[(E)-N-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-C-methylcarbonimidoyl]-2-hydroxyphenyl]methyl-diethylazanium (PubChem CID 135839881) has the molecular formula C18H24BrN4O2+ and a molecular weight of 408.32 g/mol. Its IUPAC name is [5-[(E)-N-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-C-methylcarbonimidoyl]-2-hydroxyphenyl]methyl-diethylazanium.
| Compound Name | [5-[(E)-N-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-C-methylcarbonimidoyl]-2-hydroxyphenyl]methyl-diethylazanium |
|---|---|
| PubChem CID | 135839881 |
| Molecular Formula | C18H24BrN4O2+ |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | [5-[(E)-N-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-C-methylcarbonimidoyl]-2-hydroxyphenyl]methyl-diethylazanium |
| SMILES | CC[NH+](CC)Cc1cc(/C(C)=N/NC(=O)c2cc(Br)c[nH]2)ccc1O |
| InChI | InChI=1S/C18H23BrN4O2/c1-4-23(5-2)11-14-8-13(6-7-17(14)24)12(3)21-22-18(25)16-9-15(19)10-20-16/h6-10,20,24H,4-5,11H2,1-3H3,(H,22,25)/p+1/b21-12+ |
| InChIKey | BDFVPBZIWDSYLU-CIAFOILYSA-O |
| XLogP | 2.06 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|