C19H25ClN3O+ — CID 135588219
[5-[(E)-N-(2-chloroanilino)-C-methylcarbonimidoyl]-2-hydroxyphenyl]methyl-diethylazanium (PubChem CID 135588219) has the molecular formula C19H25ClN3O+ and a molecular weight of 346.88 g/mol. Its IUPAC name is [5-[(E)-N-(2-chloroanilino)-C-methylcarbonimidoyl]-2-hydroxyphenyl]methyl-diethylazanium.
| Compound Name | [5-[(E)-N-(2-chloroanilino)-C-methylcarbonimidoyl]-2-hydroxyphenyl]methyl-diethylazanium |
|---|---|
| PubChem CID | 135588219 |
| Molecular Formula | C19H25ClN3O+ |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | [5-[(E)-N-(2-chloroanilino)-C-methylcarbonimidoyl]-2-hydroxyphenyl]methyl-diethylazanium |
| SMILES | CC[NH+](CC)Cc1cc(/C(C)=N/Nc2ccccc2Cl)ccc1O |
| InChI | InChI=1S/C19H24ClN3O/c1-4-23(5-2)13-16-12-15(10-11-19(16)24)14(3)21-22-18-9-7-6-8-17(18)20/h6-12,22,24H,4-5,13H2,1-3H3/p+1/b21-14+ |
| InChIKey | IRZDBLXTKFRTOD-KGENOOAVSA-O |
| XLogP | 3.31 |
| TPSA | 49.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|