C12H18ClN3 — CID 25018588
N'-(2-chloroanilino)-N,N-diethylethanimidamide (PubChem CID 25018588) has the molecular formula C12H18ClN3 and a molecular weight of 239.75 g/mol. Its IUPAC name is N'-(2-chloroanilino)-N,N-diethylethanimidamide.
| Compound Name | N'-(2-chloroanilino)-N,N-diethylethanimidamide |
|---|---|
| PubChem CID | 25018588 |
| Molecular Formula | C12H18ClN3 |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | N'-(2-chloroanilino)-N,N-diethylethanimidamide |
| SMILES | CCN(CC)/C(C)=N/Nc1ccccc1Cl |
| InChI | InChI=1S/C12H18ClN3/c1-4-16(5-2)10(3)14-15-12-9-7-6-8-11(12)13/h6-9,15H,4-5H2,1-3H3/b14-10+ |
| InChIKey | JCVSQADEZLXNFZ-GXDHUFHOSA-N |
| XLogP | 3.43 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|