C11H14Cl2N2O — CID 4098247
3-(2,3-dichlorophenyl)-1,1-diethylurea (PubChem CID 4098247) has the molecular formula C11H14Cl2N2O and a molecular weight of 261.15 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-1,1-diethylurea.
| Compound Name | 3-(2,3-dichlorophenyl)-1,1-diethylurea |
|---|---|
| PubChem CID | 4098247 |
| Molecular Formula | C11H14Cl2N2O |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H14Cl2N2O/c1-3-15(4-2)11(16)14-9-7-5-6-8(12)10(9)13/h5-7H,3-4H2,1-2H3,(H,14,16) |
| InChIKey | XPEWHXWVMTZNKB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |