C15H23ClN2O3 — CID 56821996
3-[3-chloro-2-(2-ethoxyethoxy)phenyl]-1,1-diethylurea (PubChem CID 56821996) has the molecular formula C15H23ClN2O3 and a molecular weight of 314.81 g/mol. Its IUPAC name is 3-[3-chloro-2-(2-ethoxyethoxy)phenyl]-1,1-diethylurea.
| Compound Name | 3-[3-chloro-2-(2-ethoxyethoxy)phenyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 56821996 |
| Molecular Formula | C15H23ClN2O3 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 3-[3-chloro-2-(2-ethoxyethoxy)phenyl]-1,1-diethylurea |
| SMILES | CCOCCOc1c(Cl)cccc1NC(=O)N(CC)CC |
| InChI | InChI=1S/C15H23ClN2O3/c1-4-18(5-2)15(19)17-13-9-7-8-12(16)14(13)21-11-10-20-6-3/h7-9H,4-6,10-11H2,1-3H3,(H,17,19) |
| InChIKey | MQRFAGNJDVYZTJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|