C19H22Cl2N2O3 — CID 60600676
1-[3-chloro-2-(2-ethoxyethoxy)phenyl]-3-[1-(4-chlorophenyl)ethyl]urea (PubChem CID 60600676) has the molecular formula C19H22Cl2N2O3 and a molecular weight of 397.30 g/mol. Its IUPAC name is 1-[3-chloro-2-(2-ethoxyethoxy)phenyl]-3-[1-(4-chlorophenyl)ethyl]urea.
| Compound Name | 1-[3-chloro-2-(2-ethoxyethoxy)phenyl]-3-[1-(4-chlorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 60600676 |
| Molecular Formula | C19H22Cl2N2O3 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 1-[3-chloro-2-(2-ethoxyethoxy)phenyl]-3-[1-(4-chlorophenyl)ethyl]urea |
| SMILES | CCOCCOc1c(Cl)cccc1NC(=O)NC(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22Cl2N2O3/c1-3-25-11-12-26-18-16(21)5-4-6-17(18)23-19(24)22-13(2)14-7-9-15(20)10-8-14/h4-10,13H,3,11-12H2,1-2H3,(H2,22,23,24) |
| InChIKey | HRDODQCZSYYUJF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|