C19H20ClF3N2O3 — CID 60600233
1-[3-chloro-2-(2-ethoxyethoxy)phenyl]-3-[[3-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 60600233) has the molecular formula C19H20ClF3N2O3 and a molecular weight of 416.83 g/mol. Its IUPAC name is 1-[3-chloro-2-(2-ethoxyethoxy)phenyl]-3-[[3-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-[3-chloro-2-(2-ethoxyethoxy)phenyl]-3-[[3-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 60600233 |
| Molecular Formula | C19H20ClF3N2O3 |
| Molecular Weight | 416.83 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 1-[3-chloro-2-(2-ethoxyethoxy)phenyl]-3-[[3-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | CCOCCOc1c(Cl)cccc1NC(=O)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H20ClF3N2O3/c1-2-27-9-10-28-17-15(20)7-4-8-16(17)25-18(26)24-12-13-5-3-6-14(11-13)19(21,22)23/h3-8,11H,2,9-10,12H2,1H3,(H2,24,25,26) |
| InChIKey | VGZUQIZDSGSGCN-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.83 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|