C18H14F3N3O — CID 11725098
1-isoquinolin-5-yl-3-[[3-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 11725098) has the molecular formula C18H14F3N3O and a molecular weight of 345.32 g/mol. Its IUPAC name is 1-isoquinolin-5-yl-3-[[3-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-isoquinolin-5-yl-3-[[3-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 11725098 |
| Molecular Formula | C18H14F3N3O |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 1-isoquinolin-5-yl-3-[[3-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)Nc1cccc2cnccc12 |
| InChI | InChI=1S/C18H14F3N3O/c19-18(20,21)14-5-1-3-12(9-14)10-23-17(25)24-16-6-2-4-13-11-22-8-7-15(13)16/h1-9,11H,10H2,(H2,23,24,25) |
| InChIKey | KPELIYBHXGTRBI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |