C24H20F3N3O — CID 143944897
aniline;N-isoquinolin-5-yl-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 143944897) has the molecular formula C24H20F3N3O and a molecular weight of 423.44 g/mol. Its IUPAC name is aniline;N-isoquinolin-5-yl-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | aniline;N-isoquinolin-5-yl-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 143944897 |
| Molecular Formula | C24H20F3N3O |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | aniline;N-isoquinolin-5-yl-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | Nc1ccccc1.O=C(Cc1ccc(C(F)(F)F)cc1)Nc1cccc2cnccc12 |
| InChI | InChI=1S/C18H13F3N2O.C6H7N/c19-18(20,21)14-6-4-12(5-7-14)10-17(24)23-16-3-1-2-13-11-22-9-8-15(13)16;7-6-4-2-1-3-5-6/h1-9,11H,10H2,(H,23,24);1-5H,7H2 |
| InChIKey | OTDFFFULUJDNKB-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|