C27H20F3N3O — CID 87600173
(2E,4E)-5-(4-aminophenyl)-N-isoquinolin-5-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 87600173) has the molecular formula C27H20F3N3O and a molecular weight of 459.47 g/mol. Its IUPAC name is (2E,4E)-5-(4-aminophenyl)-N-isoquinolin-5-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | (2E,4E)-5-(4-aminophenyl)-N-isoquinolin-5-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 87600173 |
| Molecular Formula | C27H20F3N3O |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | (2E,4E)-5-(4-aminophenyl)-N-isoquinolin-5-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | Nc1ccc(/C(=C/C=C/C(=O)Nc2cccc3cnccc23)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H20F3N3O/c28-27(29,30)21-11-7-18(8-12-21)23(19-9-13-22(31)14-10-19)4-2-6-26(34)33-25-5-1-3-20-17-32-16-15-24(20)25/h1-17H,31H2,(H,33,34)/b6-2+,23-4+ |
| InChIKey | LVDKYDJJDVUYBU-PLELZFFYSA-N |
| XLogP | 6.46 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|