C28H21F3N2O2 — CID 76533584
N-isoquinolin-5-yl-5-(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 76533584) has the molecular formula C28H21F3N2O2 and a molecular weight of 474.48 g/mol. Its IUPAC name is N-isoquinolin-5-yl-5-(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | N-isoquinolin-5-yl-5-(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 76533584 |
| Molecular Formula | C28H21F3N2O2 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | N-isoquinolin-5-yl-5-(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | COc1ccc(C(=CC=CC(=O)Nc2cccc3cnccc23)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H21F3N2O2/c1-35-23-14-10-20(11-15-23)24(19-8-12-22(13-9-19)28(29,30)31)5-3-7-27(34)33-26-6-2-4-21-18-32-17-16-25(21)26/h2-18H,1H3,(H,33,34) |
| InChIKey | ILYJNWDMHHQXJZ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|