C27H19F3N2O — CID 57386569
(2E,4E)-N-isoquinolin-5-yl-5-phenyl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 57386569) has the molecular formula C27H19F3N2O and a molecular weight of 444.46 g/mol. Its IUPAC name is (2E,4E)-N-isoquinolin-5-yl-5-phenyl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | (2E,4E)-N-isoquinolin-5-yl-5-phenyl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 57386569 |
| Molecular Formula | C27H19F3N2O |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | (2E,4E)-N-isoquinolin-5-yl-5-phenyl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | O=C(/C=C/C=C(\c1ccccc1)c1ccc(C(F)(F)F)cc1)Nc1cccc2cnccc12 |
| InChI | InChI=1S/C27H19F3N2O/c28-27(29,30)22-14-12-20(13-15-22)23(19-6-2-1-3-7-19)9-5-11-26(33)32-25-10-4-8-21-18-31-17-16-24(21)25/h1-18H,(H,32,33)/b11-5+,23-9+ |
| InChIKey | ANPYZLDKMPYWLH-VHXXFEDPSA-N |
| XLogP | 6.88 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|