C27H19F3N2O3S — CID 90900061
N-isoquinolin-5-yl-5-phenyl-5-[4-(trifluoromethylsulfonyl)phenyl]penta-2,4-dienamide (PubChem CID 90900061) has the molecular formula C27H19F3N2O3S and a molecular weight of 508.52 g/mol. Its IUPAC name is N-isoquinolin-5-yl-5-phenyl-5-[4-(trifluoromethylsulfonyl)phenyl]penta-2,4-dienamide.
| Compound Name | N-isoquinolin-5-yl-5-phenyl-5-[4-(trifluoromethylsulfonyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 90900061 |
| Molecular Formula | C27H19F3N2O3S |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | N-isoquinolin-5-yl-5-phenyl-5-[4-(trifluoromethylsulfonyl)phenyl]penta-2,4-dienamide |
| SMILES | O=C(C=CC=C(c1ccccc1)c1ccc(S(=O)(=O)C(F)(F)F)cc1)Nc1cccc2cnccc12 |
| InChI | InChI=1S/C27H19F3N2O3S/c28-27(29,30)36(34,35)22-14-12-20(13-15-22)23(19-6-2-1-3-7-19)9-5-11-26(33)32-25-10-4-8-21-18-31-17-16-24(21)25/h1-18H,(H,32,33) |
| InChIKey | PAILATFCIAPLPG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|