C26H19F3N2O2 — CID 87598371
(2E,4E)-N-isoquinolin-5-yl-5-(5-methylfuran-2-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 87598371) has the molecular formula C26H19F3N2O2 and a molecular weight of 448.44 g/mol. Its IUPAC name is (2E,4E)-N-isoquinolin-5-yl-5-(5-methylfuran-2-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | (2E,4E)-N-isoquinolin-5-yl-5-(5-methylfuran-2-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 87598371 |
| Molecular Formula | C26H19F3N2O2 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | (2E,4E)-N-isoquinolin-5-yl-5-(5-methylfuran-2-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | Cc1ccc(/C(=C/C=C/C(=O)Nc2cccc3cnccc23)c2ccc(C(F)(F)F)cc2)o1 |
| InChI | InChI=1S/C26H19F3N2O2/c1-17-8-13-24(33-17)22(18-9-11-20(12-10-18)26(27,28)29)5-3-7-25(32)31-23-6-2-4-19-16-30-15-14-21(19)23/h2-16H,1H3,(H,31,32)/b7-3+,22-5+ |
| InChIKey | ABKAONFAUGEXHB-RHPBKRJJSA-N |
| XLogP | 6.78 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|