C31H23F6NO2 — CID 25059898
(2E)-N-(7-ethoxynaphthalen-1-yl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 25059898) has the molecular formula C31H23F6NO2 and a molecular weight of 555.52 g/mol. Its IUPAC name is (2E)-N-(7-ethoxynaphthalen-1-yl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | (2E)-N-(7-ethoxynaphthalen-1-yl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 25059898 |
| Molecular Formula | C31H23F6NO2 |
| Molecular Weight | 555.52 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | (2E)-N-(7-ethoxynaphthalen-1-yl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | CCOc1ccc2cccc(NC(=O)/C=C/C=C(c3ccc(C(F)(F)F)cc3)c3ccc(C(F)(F)F)cc3)c2c1 |
| InChI | InChI=1S/C31H23F6NO2/c1-2-40-25-18-13-20-5-3-7-28(27(20)19-25)38-29(39)8-4-6-26(21-9-14-23(15-10-21)30(32,33)34)22-11-16-24(17-12-22)31(35,36)37/h3-19H,2H2,1H3,(H,38,39)/b8-4+ |
| InChIKey | XSNKVMTVTIVOJQ-XBXARRHUSA-N |
| XLogP | 8.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.52 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|