C29H25F6NO2 — CID 25059900
(2E)-N-[2-(2-hydroxy-2-methylpropyl)phenyl]-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 25059900) has the molecular formula C29H25F6NO2 and a molecular weight of 533.51 g/mol. Its IUPAC name is (2E)-N-[2-(2-hydroxy-2-methylpropyl)phenyl]-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | (2E)-N-[2-(2-hydroxy-2-methylpropyl)phenyl]-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 25059900 |
| Molecular Formula | C29H25F6NO2 |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | (2E)-N-[2-(2-hydroxy-2-methylpropyl)phenyl]-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | CC(C)(O)Cc1ccccc1NC(=O)/C=C/C=C(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H25F6NO2/c1-27(2,38)18-21-6-3-4-8-25(21)36-26(37)9-5-7-24(19-10-14-22(15-11-19)28(30,31)32)20-12-16-23(17-13-20)29(33,34)35/h3-17,38H,18H2,1-2H3,(H,36,37)/b9-5+ |
| InChIKey | DPSHDGJJDWRBCM-WEVVVXLNSA-N |
| XLogP | 7.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|