C29H24F3N3O2 — CID 90827875
5-[4-(dimethylamino)phenyl]-N-(1-oxo-2H-isoquinolin-5-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 90827875) has the molecular formula C29H24F3N3O2 and a molecular weight of 503.52 g/mol. Its IUPAC name is 5-[4-(dimethylamino)phenyl]-N-(1-oxo-2H-isoquinolin-5-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | 5-[4-(dimethylamino)phenyl]-N-(1-oxo-2H-isoquinolin-5-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 90827875 |
| Molecular Formula | C29H24F3N3O2 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 5-[4-(dimethylamino)phenyl]-N-(1-oxo-2H-isoquinolin-5-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | CN(C)c1ccc(C(=CC=CC(=O)Nc2cccc3c(=O)[nH]ccc23)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C29H24F3N3O2/c1-35(2)22-15-11-20(12-16-22)23(19-9-13-21(14-10-19)29(30,31)32)5-4-8-27(36)34-26-7-3-6-25-24(26)17-18-33-28(25)37/h3-18H,1-2H3,(H,33,37)(H,34,36) |
| InChIKey | RLHUMDVXAYWGBW-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|