C26H17F6NO3 — CID 87599332
2-[[(2E)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienoyl]amino]benzoic acid (PubChem CID 87599332) has the molecular formula C26H17F6NO3 and a molecular weight of 505.41 g/mol. Its IUPAC name is 2-[[(2E)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienoyl]amino]benzoic acid.
| Compound Name | 2-[[(2E)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 87599332 |
| Molecular Formula | C26H17F6NO3 |
| Molecular Weight | 505.41 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 2-[[(2E)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienoyl]amino]benzoic acid |
| SMILES | O=C(/C=C/C=C(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C26H17F6NO3/c27-25(28,29)18-12-8-16(9-13-18)20(17-10-14-19(15-11-17)26(30,31)32)5-3-7-23(34)33-22-6-2-1-4-21(22)24(35)36/h1-15H,(H,33,34)(H,35,36)/b7-3+ |
| InChIKey | IWTOVVQYLSENIH-XVNBXDOJSA-N |
| XLogP | 7.05 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.41 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|