C28H26F3NO4 — CID 91292795
N-[2-(1,2-dihydroxyethyl)phenyl]-5-(4-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 91292795) has the molecular formula C28H26F3NO4 and a molecular weight of 497.51 g/mol. Its IUPAC name is N-[2-(1,2-dihydroxyethyl)phenyl]-5-(4-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | N-[2-(1,2-dihydroxyethyl)phenyl]-5-(4-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 91292795 |
| Molecular Formula | C28H26F3NO4 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | N-[2-(1,2-dihydroxyethyl)phenyl]-5-(4-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | CCOc1ccc(C(=CC=CC(=O)Nc2ccccc2C(O)CO)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H26F3NO4/c1-2-36-22-16-12-20(13-17-22)23(19-10-14-21(15-11-19)28(29,30)31)7-5-9-27(35)32-25-8-4-3-6-24(25)26(34)18-33/h3-17,26,33-34H,2,18H2,1H3,(H,32,35) |
| InChIKey | AKZXVQIJPGKKSM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|