C20H18F3NO2 — CID 141194632
5-(4-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 141194632) has the molecular formula C20H18F3NO2 and a molecular weight of 361.36 g/mol. Its IUPAC name is 5-(4-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | 5-(4-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 141194632 |
| Molecular Formula | C20H18F3NO2 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 5-(4-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | CCOc1ccc(C(=CC=CC(N)=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H18F3NO2/c1-2-26-17-12-8-15(9-13-17)18(4-3-5-19(24)25)14-6-10-16(11-7-14)20(21,22)23/h3-13H,2H2,1H3,(H2,24,25) |
| InChIKey | XVOVAWLZQBANIV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|