C29H27F3N2O4 — CID 87598858
(2E,4E)-N-[3-acetamido-2-(hydroxymethyl)phenyl]-5-(4-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 87598858) has the molecular formula C29H27F3N2O4 and a molecular weight of 524.54 g/mol. Its IUPAC name is (2E,4E)-N-[3-acetamido-2-(hydroxymethyl)phenyl]-5-(4-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | (2E,4E)-N-[3-acetamido-2-(hydroxymethyl)phenyl]-5-(4-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 87598858 |
| Molecular Formula | C29H27F3N2O4 |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | (2E,4E)-N-[3-acetamido-2-(hydroxymethyl)phenyl]-5-(4-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | CCOc1ccc(/C(=C/C=C/C(=O)Nc2cccc(NC(C)=O)c2CO)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C29H27F3N2O4/c1-3-38-23-16-12-21(13-17-23)24(20-10-14-22(15-11-20)29(30,31)32)6-4-9-28(37)34-27-8-5-7-26(25(27)18-35)33-19(2)36/h4-17,35H,3,18H2,1-2H3,(H,33,36)(H,34,37)/b9-4+,24-6+ |
| InChIKey | PUOHGVLFJLZSAV-JXDLBLSBSA-N |
| XLogP | 6.18 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|