C29H25F3N2O3 — CID 87612627
(2E,4E)-5-(4-ethoxyphenyl)-N-(2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 87612627) has the molecular formula C29H25F3N2O3 and a molecular weight of 506.52 g/mol. Its IUPAC name is (2E,4E)-5-(4-ethoxyphenyl)-N-(2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | (2E,4E)-5-(4-ethoxyphenyl)-N-(2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 87612627 |
| Molecular Formula | C29H25F3N2O3 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | (2E,4E)-5-(4-ethoxyphenyl)-N-(2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | CCOc1ccc(/C(=C/C=C/C(=O)Nc2cccc3c2CCC(=O)N3)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C29H25F3N2O3/c1-2-37-22-15-11-20(12-16-22)23(19-9-13-21(14-10-19)29(30,31)32)5-3-8-27(35)33-25-6-4-7-26-24(25)17-18-28(36)34-26/h3-16H,2,17-18H2,1H3,(H,33,35)(H,34,36)/b8-3+,23-5+ |
| InChIKey | VCLJVTOXXAIRDE-YQKDECFUSA-N |
| XLogP | 6.62 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|