C30H30N2O5 — CID 87600146
(2E)-5,5-bis(4-ethoxyphenyl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)penta-2,4-dienamide (PubChem CID 87600146) has the molecular formula C30H30N2O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is (2E)-5,5-bis(4-ethoxyphenyl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)penta-2,4-dienamide.
| Compound Name | (2E)-5,5-bis(4-ethoxyphenyl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 87600146 |
| Molecular Formula | C30H30N2O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | (2E)-5,5-bis(4-ethoxyphenyl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)penta-2,4-dienamide |
| SMILES | CCOc1ccc(C(=C/C=C/C(=O)Nc2cccc3c2CC(O)C(=O)N3)c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C30H30N2O5/c1-3-36-22-15-11-20(12-16-22)24(21-13-17-23(18-14-21)37-4-2)7-5-10-29(34)31-26-8-6-9-27-25(26)19-28(33)30(35)32-27/h5-18,28,33H,3-4,19H2,1-2H3,(H,31,34)(H,32,35)/b10-5+ |
| InChIKey | VLVLWGHINCAMSH-BJMVGYQFSA-N |
| XLogP | 4.97 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|