C30H30N2O4 — CID 91605465
N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-(4-methylphenyl)-5-(4-propan-2-yloxyphenyl)penta-2,4-dienamide (PubChem CID 91605465) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-(4-methylphenyl)-5-(4-propan-2-yloxyphenyl)penta-2,4-dienamide.
| Compound Name | N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-(4-methylphenyl)-5-(4-propan-2-yloxyphenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 91605465 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-(4-methylphenyl)-5-(4-propan-2-yloxyphenyl)penta-2,4-dienamide |
| SMILES | Cc1ccc(C(=CC=CC(=O)Nc2cccc3c2CC(O)C(=O)N3)c2ccc(OC(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H30N2O4/c1-19(2)36-23-16-14-22(15-17-23)24(21-12-10-20(3)11-13-21)6-4-9-29(34)31-26-7-5-8-27-25(26)18-28(33)30(35)32-27/h4-17,19,28,33H,18H2,1-3H3,(H,31,34)(H,32,35) |
| InChIKey | XKXZEHZMGDWKAD-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|