C28H24F3N3O4 — CID 57385290
(2E,4Z)-5-(6-ethoxy-3-pyridinyl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 57385290) has the molecular formula C28H24F3N3O4 and a molecular weight of 523.51 g/mol. Its IUPAC name is (2E,4Z)-5-(6-ethoxy-3-pyridinyl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | (2E,4Z)-5-(6-ethoxy-3-pyridinyl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 57385290 |
| Molecular Formula | C28H24F3N3O4 |
| Molecular Weight | 523.51 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | (2E,4Z)-5-(6-ethoxy-3-pyridinyl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | CCOc1ccc(/C(=C\C=C\C(=O)Nc2cccc3c2CC(O)C(=O)N3)c2ccc(C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C28H24F3N3O4/c1-2-38-26-14-11-18(16-32-26)20(17-9-12-19(13-10-17)28(29,30)31)5-3-8-25(36)33-22-6-4-7-23-21(22)15-24(35)27(37)34-23/h3-14,16,24,35H,2,15H2,1H3,(H,33,36)(H,34,37)/b8-3+,20-5- |
| InChIKey | GZEPVPNNBFPUAZ-NBWKKXHRSA-N |
| XLogP | 4.98 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|