C29H25F3N2O5 — CID 90847018
5-(4-ethoxyphenyl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[4-(trifluoromethoxy)phenyl]penta-2,4-dienamide (PubChem CID 90847018) has the molecular formula C29H25F3N2O5 and a molecular weight of 538.52 g/mol. Its IUPAC name is 5-(4-ethoxyphenyl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[4-(trifluoromethoxy)phenyl]penta-2,4-dienamide.
| Compound Name | 5-(4-ethoxyphenyl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[4-(trifluoromethoxy)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 90847018 |
| Molecular Formula | C29H25F3N2O5 |
| Molecular Weight | 538.52 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | 5-(4-ethoxyphenyl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[4-(trifluoromethoxy)phenyl]penta-2,4-dienamide |
| SMILES | CCOc1ccc(C(=CC=CC(=O)Nc2cccc3c2CC(O)C(=O)N3)c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C29H25F3N2O5/c1-2-38-20-13-9-18(10-14-20)22(19-11-15-21(16-12-19)39-29(30,31)32)5-3-8-27(36)33-24-6-4-7-25-23(24)17-26(35)28(37)34-25/h3-16,26,35H,2,17H2,1H3,(H,33,36)(H,34,37) |
| InChIKey | GTXQGECVBGQJEU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|