C29H28ClF3N2O3 — CID 87599974
(2E,4E)-5-(4-ethoxyphenyl)-N-(3-hydroxy-1,2,3,4-tetrahydroquinolin-5-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide;hydrochloride (PubChem CID 87599974) has the molecular formula C29H28ClF3N2O3 and a molecular weight of 545.00 g/mol. Its IUPAC name is (2E,4E)-5-(4-ethoxyphenyl)-N-(3-hydroxy-1,2,3,4-tetrahydroquinolin-5-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide;hydrochloride.
| Compound Name | (2E,4E)-5-(4-ethoxyphenyl)-N-(3-hydroxy-1,2,3,4-tetrahydroquinolin-5-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide;hydrochloride |
|---|---|
| PubChem CID | 87599974 |
| Molecular Formula | C29H28ClF3N2O3 |
| Molecular Weight | 545.00 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | (2E,4E)-5-(4-ethoxyphenyl)-N-(3-hydroxy-1,2,3,4-tetrahydroquinolin-5-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide;hydrochloride |
| SMILES | CCOc1ccc(/C(=C/C=C/C(=O)Nc2cccc3c2CC(O)CN3)c2ccc(C(F)(F)F)cc2)cc1.Cl |
| InChI | InChI=1S/C29H27F3N2O3.ClH/c1-2-37-23-15-11-20(12-16-23)24(19-9-13-21(14-10-19)29(30,31)32)5-3-8-28(36)34-27-7-4-6-26-25(27)17-22(35)18-33-26;/h3-16,22,33,35H,2,17-18H2,1H3,(H,34,36);1H/b8-3+,24-5+; |
| InChIKey | KIKNWYGOAPUVDA-FPIBCJTISA-N |
| XLogP | 6.48 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.00 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|