C28H20F6N2O3 — CID 91279552
N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 91279552) has the molecular formula C28H20F6N2O3 and a molecular weight of 546.47 g/mol. Its IUPAC name is N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 91279552 |
| Molecular Formula | C28H20F6N2O3 |
| Molecular Weight | 546.47 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | O=C(C=CC=C(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)Nc1cccc2c1CC(O)C(=O)N2 |
| InChI | InChI=1S/C28H20F6N2O3/c29-27(30,31)18-11-7-16(8-12-18)20(17-9-13-19(14-10-17)28(32,33)34)3-1-6-25(38)35-22-4-2-5-23-21(22)15-24(37)26(39)36-23/h1-14,24,37H,15H2,(H,35,38)(H,36,39) |
| InChIKey | TUVIJLYJBUYMDN-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.47 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|