C32H30F3N3O3 — CID 57387587
(2E,4Z)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-(4-piperidin-1-ylphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 57387587) has the molecular formula C32H30F3N3O3 and a molecular weight of 561.60 g/mol. Its IUPAC name is (2E,4Z)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-(4-piperidin-1-ylphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | (2E,4Z)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-(4-piperidin-1-ylphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 57387587 |
| Molecular Formula | C32H30F3N3O3 |
| Molecular Weight | 561.60 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | (2E,4Z)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-(4-piperidin-1-ylphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | O=C(/C=C/C=C(\c1ccc(N2CCCCC2)cc1)c1ccc(C(F)(F)F)cc1)Nc1cccc2c1CC(O)C(=O)N2 |
| InChI | InChI=1S/C32H30F3N3O3/c33-32(34,35)23-14-10-21(11-15-23)25(22-12-16-24(17-13-22)38-18-2-1-3-19-38)6-4-9-30(40)36-27-7-5-8-28-26(27)20-29(39)31(41)37-28/h4-17,29,39H,1-3,18-20H2,(H,36,40)(H,37,41)/b9-4+,25-6- |
| InChIKey | XHXIJVGAYZIWMZ-WWKUCMIFSA-N |
| XLogP | 6.18 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.60 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|