C31H29F3N4O4 — CID 87599909
(2E,4Z)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[6-(1,4-oxazepan-4-yl)-3-pyridinyl]-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 87599909) has the molecular formula C31H29F3N4O4 and a molecular weight of 578.59 g/mol. Its IUPAC name is (2E,4Z)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[6-(1,4-oxazepan-4-yl)-3-pyridinyl]-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | (2E,4Z)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[6-(1,4-oxazepan-4-yl)-3-pyridinyl]-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 87599909 |
| Molecular Formula | C31H29F3N4O4 |
| Molecular Weight | 578.59 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | (2E,4Z)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[6-(1,4-oxazepan-4-yl)-3-pyridinyl]-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | O=C(/C=C/C=C(/c1ccc(C(F)(F)F)cc1)c1ccc(N2CCCOCC2)nc1)Nc1cccc2c1CC(O)C(=O)N2 |
| InChI | InChI=1S/C31H29F3N4O4/c32-31(33,34)22-11-8-20(9-12-22)23(21-10-13-28(35-19-21)38-14-3-16-42-17-15-38)4-1-7-29(40)36-25-5-2-6-26-24(25)18-27(39)30(41)37-26/h1-2,4-13,19,27,39H,3,14-18H2,(H,36,40)(H,37,41)/b7-1+,23-4- |
| InChIKey | RFWPTVMFKDRHDE-UQTMWXQDSA-N |
| XLogP | 4.81 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|