C26H20F3N3O3 — CID 86633263
(2E,4Z)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-pyridin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 86633263) has the molecular formula C26H20F3N3O3 and a molecular weight of 479.46 g/mol. Its IUPAC name is (2E,4Z)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-pyridin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | (2E,4Z)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-pyridin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 86633263 |
| Molecular Formula | C26H20F3N3O3 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | (2E,4Z)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-pyridin-4-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | O=C(/C=C/C=C(\c1ccncc1)c1ccc(C(F)(F)F)cc1)Nc1cccc2c1CC(O)C(=O)N2 |
| InChI | InChI=1S/C26H20F3N3O3/c27-26(28,29)18-9-7-16(8-10-18)19(17-11-13-30-14-12-17)3-1-6-24(34)31-21-4-2-5-22-20(21)15-23(33)25(35)32-22/h1-14,23,33H,15H2,(H,31,34)(H,32,35)/b6-1+,19-3- |
| InChIKey | HOJYMKCIABHISP-MGGAGMQCSA-N |
| XLogP | 4.58 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|