C28H21F3N2O5 — CID 91103178
5-(1,3-benzodioxol-5-yl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 91103178) has the molecular formula C28H21F3N2O5 and a molecular weight of 522.48 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 91103178 |
| Molecular Formula | C28H21F3N2O5 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | O=C(C=CC=C(c1ccc(C(F)(F)F)cc1)c1ccc2c(c1)OCO2)Nc1cccc2c1CC(O)C(=O)N2 |
| InChI | InChI=1S/C28H21F3N2O5/c29-28(30,31)18-10-7-16(8-11-18)19(17-9-12-24-25(13-17)38-15-37-24)3-1-6-26(35)32-21-4-2-5-22-20(21)14-23(34)27(36)33-22/h1-13,23,34H,14-15H2,(H,32,35)(H,33,36) |
| InChIKey | NDGMYMVSVHBQEU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|