C31H30ClN3O3 — CID 87598497
(2E,4Z)-5-(4-chlorophenyl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-(4-piperidin-1-ylphenyl)penta-2,4-dienamide (PubChem CID 87598497) has the molecular formula C31H30ClN3O3 and a molecular weight of 528.05 g/mol. Its IUPAC name is (2E,4Z)-5-(4-chlorophenyl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-(4-piperidin-1-ylphenyl)penta-2,4-dienamide.
| Compound Name | (2E,4Z)-5-(4-chlorophenyl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-(4-piperidin-1-ylphenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 87598497 |
| Molecular Formula | C31H30ClN3O3 |
| Molecular Weight | 528.05 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | (2E,4Z)-5-(4-chlorophenyl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-(4-piperidin-1-ylphenyl)penta-2,4-dienamide |
| SMILES | O=C(/C=C/C=C(\c1ccc(Cl)cc1)c1ccc(N2CCCCC2)cc1)Nc1cccc2c1CC(O)C(=O)N2 |
| InChI | InChI=1S/C31H30ClN3O3/c32-23-14-10-21(11-15-23)25(22-12-16-24(17-13-22)35-18-2-1-3-19-35)6-4-9-30(37)33-27-7-5-8-28-26(27)20-29(36)31(38)34-28/h4-17,29,36H,1-3,18-20H2,(H,33,37)(H,34,38)/b9-4+,25-6+ |
| InChIKey | NNGQPOXQJJVLNX-OEMPDITHSA-N |
| XLogP | 5.81 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.05 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|