C20H20Cl2N2O — CID 4028317
3-(4-chlorophenyl)-N-(3-chloro-2-piperidin-1-ylphenyl)prop-2-enamide (PubChem CID 4028317) has the molecular formula C20H20Cl2N2O and a molecular weight of 375.30 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(3-chloro-2-piperidin-1-ylphenyl)prop-2-enamide.
| Compound Name | 3-(4-chlorophenyl)-N-(3-chloro-2-piperidin-1-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4028317 |
| Molecular Formula | C20H20Cl2N2O |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(3-chloro-2-piperidin-1-ylphenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1)Nc1cccc(Cl)c1N1CCCCC1 |
| InChI | InChI=1S/C20H20Cl2N2O/c21-16-10-7-15(8-11-16)9-12-19(25)23-18-6-4-5-17(22)20(18)24-13-2-1-3-14-24/h4-12H,1-3,13-14H2,(H,23,25) |
| InChIKey | UDPYYZBPQGFMBV-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|