C19H19Cl2N3OS — CID 3933868
2-(4-chlorophenyl)-N-[(3-chloro-2-pyrrolidin-1-ylphenyl)carbamothioyl]acetamide (PubChem CID 3933868) has the molecular formula C19H19Cl2N3OS and a molecular weight of 408.35 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(3-chloro-2-pyrrolidin-1-ylphenyl)carbamothioyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(3-chloro-2-pyrrolidin-1-ylphenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3933868 |
| Molecular Formula | C19H19Cl2N3OS |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(3-chloro-2-pyrrolidin-1-ylphenyl)carbamothioyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NC(=S)Nc1cccc(Cl)c1N1CCCC1 |
| InChI | InChI=1S/C19H19Cl2N3OS/c20-14-8-6-13(7-9-14)12-17(25)23-19(26)22-16-5-3-4-15(21)18(16)24-10-1-2-11-24/h3-9H,1-2,10-12H2,(H2,22,23,25,26) |
| InChIKey | YHEUUGLHLDYWLF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|