C15H13ClN2O2S — CID 817114
2-(4-chlorophenyl)-N-[(2-hydroxyphenyl)carbamothioyl]acetamide (PubChem CID 817114) has the molecular formula C15H13ClN2O2S and a molecular weight of 320.80 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(2-hydroxyphenyl)carbamothioyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(2-hydroxyphenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 817114 |
| Molecular Formula | C15H13ClN2O2S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(2-hydroxyphenyl)carbamothioyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NC(=S)Nc1ccccc1O |
| InChI | InChI=1S/C15H13ClN2O2S/c16-11-7-5-10(6-8-11)9-14(20)18-15(21)17-12-3-1-2-4-13(12)19/h1-8,19H,9H2,(H2,17,18,20,21) |
| InChIKey | GOPQFUDBVRDPCU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|