C24H22ClN3O2S — CID 4944628
2-[[2-(4-chlorophenyl)acetyl]carbamothioylamino]-N-(3,4-dimethylphenyl)benzamide (PubChem CID 4944628) has the molecular formula C24H22ClN3O2S and a molecular weight of 451.98 g/mol. Its IUPAC name is 2-[[2-(4-chlorophenyl)acetyl]carbamothioylamino]-N-(3,4-dimethylphenyl)benzamide.
| Compound Name | 2-[[2-(4-chlorophenyl)acetyl]carbamothioylamino]-N-(3,4-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 4944628 |
| Molecular Formula | C24H22ClN3O2S |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 2-[[2-(4-chlorophenyl)acetyl]carbamothioylamino]-N-(3,4-dimethylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2NC(=S)NC(=O)Cc2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C24H22ClN3O2S/c1-15-7-12-19(13-16(15)2)26-23(30)20-5-3-4-6-21(20)27-24(31)28-22(29)14-17-8-10-18(25)11-9-17/h3-13H,14H2,1-2H3,(H,26,30)(H2,27,28,29,31) |
| InChIKey | NILMPMFZXMUPCD-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|