C23H22ClN3O3S2 — CID 4936881
2-(4-chlorophenyl)-N-[[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]acetamide (PubChem CID 4936881) has the molecular formula C23H22ClN3O3S2 and a molecular weight of 488.03 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 4936881 |
| Molecular Formula | C23H22ClN3O3S2 |
| Molecular Weight | 488.03 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]acetamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)Cc3ccc(Cl)cc3)cc2)cc1C |
| InChI | InChI=1S/C23H22ClN3O3S2/c1-15-3-8-20(13-16(15)2)27-32(29,30)21-11-9-19(10-12-21)25-23(31)26-22(28)14-17-4-6-18(24)7-5-17/h3-13,27H,14H2,1-2H3,(H2,25,26,28,31) |
| InChIKey | CRWHOYKNJLPPQG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.03 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|