C21H23ClN4O3S — CID 4937162
4-[2-[[2-(4-chlorophenyl)acetyl]carbamothioyl]hydrazinyl]-N-(3,4-dimethylphenyl)-4-oxobutanamide (PubChem CID 4937162) has the molecular formula C21H23ClN4O3S and a molecular weight of 446.96 g/mol. Its IUPAC name is 4-[2-[[2-(4-chlorophenyl)acetyl]carbamothioyl]hydrazinyl]-N-(3,4-dimethylphenyl)-4-oxobutanamide.
| Compound Name | 4-[2-[[2-(4-chlorophenyl)acetyl]carbamothioyl]hydrazinyl]-N-(3,4-dimethylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 4937162 |
| Molecular Formula | C21H23ClN4O3S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 4-[2-[[2-(4-chlorophenyl)acetyl]carbamothioyl]hydrazinyl]-N-(3,4-dimethylphenyl)-4-oxobutanamide |
| SMILES | Cc1ccc(NC(=O)CCC(=O)NNC(=S)NC(=O)Cc2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C21H23ClN4O3S/c1-13-3-8-17(11-14(13)2)23-18(27)9-10-19(28)25-26-21(30)24-20(29)12-15-4-6-16(22)7-5-15/h3-8,11H,9-10,12H2,1-2H3,(H,23,27)(H,25,28)(H2,24,26,29,30) |
| InChIKey | NOABKEBMYQOCNR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|