C20H21BrN4O3S — CID 5087848
2-bromo-N-[[[4-(3,4-dimethylanilino)-4-oxobutanoyl]amino]carbamothioyl]benzamide (PubChem CID 5087848) has the molecular formula C20H21BrN4O3S and a molecular weight of 477.38 g/mol. Its IUPAC name is 2-bromo-N-[[[4-(3,4-dimethylanilino)-4-oxobutanoyl]amino]carbamothioyl]benzamide.
| Compound Name | 2-bromo-N-[[[4-(3,4-dimethylanilino)-4-oxobutanoyl]amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 5087848 |
| Molecular Formula | C20H21BrN4O3S |
| Molecular Weight | 477.38 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | 2-bromo-N-[[[4-(3,4-dimethylanilino)-4-oxobutanoyl]amino]carbamothioyl]benzamide |
| SMILES | Cc1ccc(NC(=O)CCC(=O)NNC(=S)NC(=O)c2ccccc2Br)cc1C |
| InChI | InChI=1S/C20H21BrN4O3S/c1-12-7-8-14(11-13(12)2)22-17(26)9-10-18(27)24-25-20(29)23-19(28)15-5-3-4-6-16(15)21/h3-8,11H,9-10H2,1-2H3,(H,22,26)(H,24,27)(H2,23,25,28,29) |
| InChIKey | FWIYRPISEIWQHT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|