C25H32N4O4S — CID 5167547
4-[2-[[2-(4-tert-butylphenoxy)acetyl]carbamothioyl]hydrazinyl]-N-(3,4-dimethylphenyl)-4-oxobutanamide (PubChem CID 5167547) has the molecular formula C25H32N4O4S and a molecular weight of 484.62 g/mol. Its IUPAC name is 4-[2-[[2-(4-tert-butylphenoxy)acetyl]carbamothioyl]hydrazinyl]-N-(3,4-dimethylphenyl)-4-oxobutanamide.
| Compound Name | 4-[2-[[2-(4-tert-butylphenoxy)acetyl]carbamothioyl]hydrazinyl]-N-(3,4-dimethylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 5167547 |
| Molecular Formula | C25H32N4O4S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 4-[2-[[2-(4-tert-butylphenoxy)acetyl]carbamothioyl]hydrazinyl]-N-(3,4-dimethylphenyl)-4-oxobutanamide |
| SMILES | Cc1ccc(NC(=O)CCC(=O)NNC(=S)NC(=O)COc2ccc(C(C)(C)C)cc2)cc1C |
| InChI | InChI=1S/C25H32N4O4S/c1-16-6-9-19(14-17(16)2)26-21(30)12-13-22(31)28-29-24(34)27-23(32)15-33-20-10-7-18(8-11-20)25(3,4)5/h6-11,14H,12-13,15H2,1-5H3,(H,26,30)(H,28,31)(H2,27,29,32,34) |
| InChIKey | WTDLBQPKKKCLTA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|