C28H39N3O4 — CID 17356767
4-[2-[2-(2,4-ditert-butylphenoxy)acetyl]hydrazinyl]-N-(3,4-dimethylphenyl)-4-oxobutanamide (PubChem CID 17356767) has the molecular formula C28H39N3O4 and a molecular weight of 481.64 g/mol. Its IUPAC name is 4-[2-[2-(2,4-ditert-butylphenoxy)acetyl]hydrazinyl]-N-(3,4-dimethylphenyl)-4-oxobutanamide.
| Compound Name | 4-[2-[2-(2,4-ditert-butylphenoxy)acetyl]hydrazinyl]-N-(3,4-dimethylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 17356767 |
| Molecular Formula | C28H39N3O4 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | 4-[2-[2-(2,4-ditert-butylphenoxy)acetyl]hydrazinyl]-N-(3,4-dimethylphenyl)-4-oxobutanamide |
| SMILES | Cc1ccc(NC(=O)CCC(=O)NNC(=O)COc2ccc(C(C)(C)C)cc2C(C)(C)C)cc1C |
| InChI | InChI=1S/C28H39N3O4/c1-18-9-11-21(15-19(18)2)29-24(32)13-14-25(33)30-31-26(34)17-35-23-12-10-20(27(3,4)5)16-22(23)28(6,7)8/h9-12,15-16H,13-14,17H2,1-8H3,(H,29,32)(H,30,33)(H,31,34) |
| InChIKey | BEXKPBWRHBPYBN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|