C40H64N2O4 — CID 17233420
2-(2,4-ditert-butylphenoxy)-N-[8-[[2-(2,4-ditert-butylphenoxy)acetyl]amino]octyl]acetamide (PubChem CID 17233420) has the molecular formula C40H64N2O4 and a molecular weight of 636.96 g/mol. Its IUPAC name is 2-(2,4-ditert-butylphenoxy)-N-[8-[[2-(2,4-ditert-butylphenoxy)acetyl]amino]octyl]acetamide.
| Compound Name | 2-(2,4-ditert-butylphenoxy)-N-[8-[[2-(2,4-ditert-butylphenoxy)acetyl]amino]octyl]acetamide |
|---|---|
| PubChem CID | 17233420 |
| Molecular Formula | C40H64N2O4 |
| Molecular Weight | 636.96 g/mol |
| Exact Mass | 636.49 |
| IUPAC Name | 2-(2,4-ditert-butylphenoxy)-N-[8-[[2-(2,4-ditert-butylphenoxy)acetyl]amino]octyl]acetamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)NCCCCCCCCNC(=O)COc2ccc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C40H64N2O4/c1-37(2,3)29-19-21-33(31(25-29)39(7,8)9)45-27-35(43)41-23-17-15-13-14-16-18-24-42-36(44)28-46-34-22-20-30(38(4,5)6)26-32(34)40(10,11)12/h19-22,25-26H,13-18,23-24,27-28H2,1-12H3,(H,41,43)(H,42,44) |
| InChIKey | AZWGEUNSAIUHFR-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.96 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|