C22H36N2O3 — CID 17356816
N'-[2-(2,4-ditert-butylphenoxy)acetyl]hexanehydrazide (PubChem CID 17356816) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is N'-[2-(2,4-ditert-butylphenoxy)acetyl]hexanehydrazide.
| Compound Name | N'-[2-(2,4-ditert-butylphenoxy)acetyl]hexanehydrazide |
|---|---|
| PubChem CID | 17356816 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | N'-[2-(2,4-ditert-butylphenoxy)acetyl]hexanehydrazide |
| SMILES | CCCCCC(=O)NNC(=O)COc1ccc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C22H36N2O3/c1-8-9-10-11-19(25)23-24-20(26)15-27-18-13-12-16(21(2,3)4)14-17(18)22(5,6)7/h12-14H,8-11,15H2,1-7H3,(H,23,25)(H,24,26) |
| InChIKey | QEFZDINWSAMEDP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|