C18H27BrN2O3 — CID 17051882
N'-[2-(4-bromo-2-tert-butylphenoxy)acetyl]hexanehydrazide (PubChem CID 17051882) has the molecular formula C18H27BrN2O3 and a molecular weight of 399.33 g/mol. Its IUPAC name is N'-[2-(4-bromo-2-tert-butylphenoxy)acetyl]hexanehydrazide.
| Compound Name | N'-[2-(4-bromo-2-tert-butylphenoxy)acetyl]hexanehydrazide |
|---|---|
| PubChem CID | 17051882 |
| Molecular Formula | C18H27BrN2O3 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N'-[2-(4-bromo-2-tert-butylphenoxy)acetyl]hexanehydrazide |
| SMILES | CCCCCC(=O)NNC(=O)COc1ccc(Br)cc1C(C)(C)C |
| InChI | InChI=1S/C18H27BrN2O3/c1-5-6-7-8-16(22)20-21-17(23)12-24-15-10-9-13(19)11-14(15)18(2,3)4/h9-11H,5-8,12H2,1-4H3,(H,20,22)(H,21,23) |
| InChIKey | ZJJSQESEFTZNGN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|