C22H27BrN2O6 — CID 17051826
N'-[2-(4-bromo-2-tert-butylphenoxy)acetyl]-3,4,5-trimethoxybenzohydrazide (PubChem CID 17051826) has the molecular formula C22H27BrN2O6 and a molecular weight of 495.37 g/mol. Its IUPAC name is N'-[2-(4-bromo-2-tert-butylphenoxy)acetyl]-3,4,5-trimethoxybenzohydrazide.
| Compound Name | N'-[2-(4-bromo-2-tert-butylphenoxy)acetyl]-3,4,5-trimethoxybenzohydrazide |
|---|---|
| PubChem CID | 17051826 |
| Molecular Formula | C22H27BrN2O6 |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | N'-[2-(4-bromo-2-tert-butylphenoxy)acetyl]-3,4,5-trimethoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)COc2ccc(Br)cc2C(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C22H27BrN2O6/c1-22(2,3)15-11-14(23)7-8-16(15)31-12-19(26)24-25-21(27)13-9-17(28-4)20(30-6)18(10-13)29-5/h7-11H,12H2,1-6H3,(H,24,26)(H,25,27) |
| InChIKey | RJJFKNDSQVJHAG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|