C25H33BrN2O4 — CID 19190052
2-(4-bromo-2-tert-butylphenoxy)-N-[(E)-(3-methoxy-4-pentoxyphenyl)methylideneamino]acetamide (PubChem CID 19190052) has the molecular formula C25H33BrN2O4 and a molecular weight of 505.45 g/mol. Its IUPAC name is 2-(4-bromo-2-tert-butylphenoxy)-N-[(E)-(3-methoxy-4-pentoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-bromo-2-tert-butylphenoxy)-N-[(E)-(3-methoxy-4-pentoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 19190052 |
| Molecular Formula | C25H33BrN2O4 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 2-(4-bromo-2-tert-butylphenoxy)-N-[(E)-(3-methoxy-4-pentoxyphenyl)methylideneamino]acetamide |
| SMILES | CCCCCOc1ccc(/C=N/NC(=O)COc2ccc(Br)cc2C(C)(C)C)cc1OC |
| InChI | InChI=1S/C25H33BrN2O4/c1-6-7-8-13-31-22-11-9-18(14-23(22)30-5)16-27-28-24(29)17-32-21-12-10-19(26)15-20(21)25(2,3)4/h9-12,14-16H,6-8,13,17H2,1-5H3,(H,28,29)/b27-16+ |
| InChIKey | FOOIQFDNRFMHJT-JVWAILMASA-N |
| XLogP | 5.85 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|