C24H31BrN2O4 — CID 19207986
2-(4-bromo-2-propan-2-ylphenoxy)-N-[(E)-(3-methoxy-4-pentoxyphenyl)methylideneamino]acetamide (PubChem CID 19207986) has the molecular formula C24H31BrN2O4 and a molecular weight of 491.43 g/mol. Its IUPAC name is 2-(4-bromo-2-propan-2-ylphenoxy)-N-[(E)-(3-methoxy-4-pentoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-bromo-2-propan-2-ylphenoxy)-N-[(E)-(3-methoxy-4-pentoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 19207986 |
| Molecular Formula | C24H31BrN2O4 |
| Molecular Weight | 491.43 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 2-(4-bromo-2-propan-2-ylphenoxy)-N-[(E)-(3-methoxy-4-pentoxyphenyl)methylideneamino]acetamide |
| SMILES | CCCCCOc1ccc(/C=N/NC(=O)COc2ccc(Br)cc2C(C)C)cc1OC |
| InChI | InChI=1S/C24H31BrN2O4/c1-5-6-7-12-30-22-10-8-18(13-23(22)29-4)15-26-27-24(28)16-31-21-11-9-19(25)14-20(21)17(2)3/h8-11,13-15,17H,5-7,12,16H2,1-4H3,(H,27,28)/b26-15+ |
| InChIKey | WBRRZIDOSCGQLB-CVKSISIWSA-N |
| XLogP | 5.68 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.43 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|