C26H35BrN2O4 — CID 19190083
2-(4-bromo-2-tert-butylphenoxy)-N-[(E)-(4-hexoxy-3-methoxyphenyl)methylideneamino]acetamide (PubChem CID 19190083) has the molecular formula C26H35BrN2O4 and a molecular weight of 519.48 g/mol. Its IUPAC name is 2-(4-bromo-2-tert-butylphenoxy)-N-[(E)-(4-hexoxy-3-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-bromo-2-tert-butylphenoxy)-N-[(E)-(4-hexoxy-3-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 19190083 |
| Molecular Formula | C26H35BrN2O4 |
| Molecular Weight | 519.48 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 2-(4-bromo-2-tert-butylphenoxy)-N-[(E)-(4-hexoxy-3-methoxyphenyl)methylideneamino]acetamide |
| SMILES | CCCCCCOc1ccc(/C=N/NC(=O)COc2ccc(Br)cc2C(C)(C)C)cc1OC |
| InChI | InChI=1S/C26H35BrN2O4/c1-6-7-8-9-14-32-23-12-10-19(15-24(23)31-5)17-28-29-25(30)18-33-22-13-11-20(27)16-21(22)26(2,3)4/h10-13,15-17H,6-9,14,18H2,1-5H3,(H,29,30)/b28-17+ |
| InChIKey | WVLBUULFICNLRE-OGLMXYFKSA-N |
| XLogP | 6.24 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.48 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|